C14H17ClF2N2O — CID 82889686
2-(2-chloro-4,6-difluoroanilino)-N-cyclohexylacetamide (PubChem CID 82889686) has the molecular formula C14H17ClF2N2O and a molecular weight of 302.75 g/mol. Its IUPAC name is 2-(2-chloro-4,6-difluoroanilino)-N-cyclohexylacetamide.
| Compound Name | 2-(2-chloro-4,6-difluoroanilino)-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 82889686 |
| Molecular Formula | C14H17ClF2N2O |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(2-chloro-4,6-difluoroanilino)-N-cyclohexylacetamide |
| SMILES | O=C(CNc1c(F)cc(F)cc1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C14H17ClF2N2O/c15-11-6-9(16)7-12(17)14(11)18-8-13(20)19-10-4-2-1-3-5-10/h6-7,10,18H,1-5,8H2,(H,19,20) |
| InChIKey | GMWLTSRAYMKQCO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |