C14H17F3N2O — CID 62815906
N-cyclohexyl-2-(2,4,5-trifluoroanilino)acetamide (PubChem CID 62815906) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,4,5-trifluoroanilino)acetamide.
| Compound Name | N-cyclohexyl-2-(2,4,5-trifluoroanilino)acetamide |
|---|---|
| PubChem CID | 62815906 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-cyclohexyl-2-(2,4,5-trifluoroanilino)acetamide |
| SMILES | O=C(CNc1cc(F)c(F)cc1F)NC1CCCCC1 |
| InChI | InChI=1S/C14H17F3N2O/c15-10-6-12(17)13(7-11(10)16)18-8-14(20)19-9-4-2-1-3-5-9/h6-7,9,18H,1-5,8H2,(H,19,20) |
| InChIKey | NWXZBOVOEQFYDT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|