C15H19F3N2O — CID 62810286
N-cycloheptyl-2-(3,4,5-trifluoroanilino)acetamide (PubChem CID 62810286) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is N-cycloheptyl-2-(3,4,5-trifluoroanilino)acetamide.
| Compound Name | N-cycloheptyl-2-(3,4,5-trifluoroanilino)acetamide |
|---|---|
| PubChem CID | 62810286 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-cycloheptyl-2-(3,4,5-trifluoroanilino)acetamide |
| SMILES | O=C(CNc1cc(F)c(F)c(F)c1)NC1CCCCCC1 |
| InChI | InChI=1S/C15H19F3N2O/c16-12-7-11(8-13(17)15(12)18)19-9-14(21)20-10-5-3-1-2-4-6-10/h7-8,10,19H,1-6,9H2,(H,20,21) |
| InChIKey | YNKPBOUUBNRCDO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|