C8H7ClF3N — CID 83081590
2-chloro-4,6-difluoro-N-(2-fluoroethyl)aniline (PubChem CID 83081590) has the molecular formula C8H7ClF3N and a molecular weight of 209.60 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-(2-fluoroethyl)aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-(2-fluoroethyl)aniline |
|---|---|
| PubChem CID | 83081590 |
| Molecular Formula | C8H7ClF3N |
| Molecular Weight | 209.60 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-(2-fluoroethyl)aniline |
| SMILES | FCCNc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C8H7ClF3N/c9-6-3-5(11)4-7(12)8(6)13-2-1-10/h3-4,13H,1-2H2 |
| InChIKey | IUSQJWADOLTWFO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |