C10H12ClF2NO2S — CID 82889250
2-chloro-4,6-difluoro-N-(3-methylsulfonylpropyl)aniline (PubChem CID 82889250) has the molecular formula C10H12ClF2NO2S and a molecular weight of 283.73 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-(3-methylsulfonylpropyl)aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-(3-methylsulfonylpropyl)aniline |
|---|---|
| PubChem CID | 82889250 |
| Molecular Formula | C10H12ClF2NO2S |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-(3-methylsulfonylpropyl)aniline |
| SMILES | CS(=O)(=O)CCCNc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C10H12ClF2NO2S/c1-17(15,16)4-2-3-14-10-8(11)5-7(12)6-9(10)13/h5-6,14H,2-4H2,1H3 |
| InChIKey | FXPMQNRRDJICSP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|