C10H13ClF2N2O2S — CID 114141795
4-amino-N-(2-chloro-4,6-difluorophenyl)butane-1-sulfonamide (PubChem CID 114141795) has the molecular formula C10H13ClF2N2O2S and a molecular weight of 298.74 g/mol. Its IUPAC name is 4-amino-N-(2-chloro-4,6-difluorophenyl)butane-1-sulfonamide.
| Compound Name | 4-amino-N-(2-chloro-4,6-difluorophenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 114141795 |
| Molecular Formula | C10H13ClF2N2O2S |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-amino-N-(2-chloro-4,6-difluorophenyl)butane-1-sulfonamide |
| SMILES | NCCCCS(=O)(=O)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C10H13ClF2N2O2S/c11-8-5-7(12)6-9(13)10(8)15-18(16,17)4-2-1-3-14/h5-6,15H,1-4,14H2 |
| InChIKey | QLMQSAMTQMLNII-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|