C9H9Cl2F2N — CID 83079484
2,6-dichloro-4-fluoro-N-(3-fluoropropyl)aniline (PubChem CID 83079484) has the molecular formula C9H9Cl2F2N and a molecular weight of 240.08 g/mol. Its IUPAC name is 2,6-dichloro-4-fluoro-N-(3-fluoropropyl)aniline.
| Compound Name | 2,6-dichloro-4-fluoro-N-(3-fluoropropyl)aniline |
|---|---|
| PubChem CID | 83079484 |
| Molecular Formula | C9H9Cl2F2N |
| Molecular Weight | 240.08 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 2,6-dichloro-4-fluoro-N-(3-fluoropropyl)aniline |
| SMILES | FCCCNc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C9H9Cl2F2N/c10-7-4-6(13)5-8(11)9(7)14-3-1-2-12/h4-5,14H,1-3H2 |
| InChIKey | FHBREIFCUZPVFI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.08 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|