C9H8F5N — CID 107644218
2,3,5,6-tetrafluoro-N-(3-fluoropropyl)aniline (PubChem CID 107644218) has the molecular formula C9H8F5N and a molecular weight of 225.16 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(3-fluoropropyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-(3-fluoropropyl)aniline |
|---|---|
| PubChem CID | 107644218 |
| Molecular Formula | C9H8F5N |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(3-fluoropropyl)aniline |
| SMILES | FCCCNc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H8F5N/c10-2-1-3-15-9-7(13)5(11)4-6(12)8(9)14/h4,15H,1-3H2 |
| InChIKey | RSNFPVMUJJATBL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|