C9H9BrF3N — CID 102853522
5-bromo-2,4-difluoro-N-(3-fluoropropyl)aniline (PubChem CID 102853522) has the molecular formula C9H9BrF3N and a molecular weight of 268.08 g/mol. Its IUPAC name is 5-bromo-2,4-difluoro-N-(3-fluoropropyl)aniline.
| Compound Name | 5-bromo-2,4-difluoro-N-(3-fluoropropyl)aniline |
|---|---|
| PubChem CID | 102853522 |
| Molecular Formula | C9H9BrF3N |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 5-bromo-2,4-difluoro-N-(3-fluoropropyl)aniline |
| SMILES | FCCCNc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C9H9BrF3N/c10-6-4-9(14-3-1-2-11)8(13)5-7(6)12/h4-5,14H,1-3H2 |
| InChIKey | BPJQPOPBXHTAJU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|