C9H8BrF2N — CID 102847120
5-bromo-2,4-difluoro-N-prop-2-enylaniline (PubChem CID 102847120) has the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. Its IUPAC name is 5-bromo-2,4-difluoro-N-prop-2-enylaniline.
| Compound Name | 5-bromo-2,4-difluoro-N-prop-2-enylaniline |
|---|---|
| PubChem CID | 102847120 |
| Molecular Formula | C9H8BrF2N |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 5-bromo-2,4-difluoro-N-prop-2-enylaniline |
| SMILES | C=CCNc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C9H8BrF2N/c1-2-3-13-9-4-6(10)7(11)5-8(9)12/h2,4-5,13H,1,3H2 |
| InChIKey | ATPWHCZCDOJNMT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|