C9H8ClF2N — CID 130606522
5-chloro-2,3-difluoro-N-prop-2-enylaniline (PubChem CID 130606522) has the molecular formula C9H8ClF2N and a molecular weight of 203.62 g/mol. Its IUPAC name is 5-chloro-2,3-difluoro-N-prop-2-enylaniline.
| Compound Name | 5-chloro-2,3-difluoro-N-prop-2-enylaniline |
|---|---|
| PubChem CID | 130606522 |
| Molecular Formula | C9H8ClF2N |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 5-chloro-2,3-difluoro-N-prop-2-enylaniline |
| SMILES | C=CCNc1cc(Cl)cc(F)c1F |
| InChI | InChI=1S/C9H8ClF2N/c1-2-3-13-8-5-6(10)4-7(11)9(8)12/h2,4-5,13H,1,3H2 |
| InChIKey | IHGIYTBVNAABHI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|