C9H11ClN2 — CID 15219986
2-chloro-1-N-prop-2-enylbenzene-1,4-diamine (PubChem CID 15219986) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 2-chloro-1-N-prop-2-enylbenzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-prop-2-enylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 15219986 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-chloro-1-N-prop-2-enylbenzene-1,4-diamine |
| SMILES | C=CCNc1ccc(N)cc1Cl |
| InChI | InChI=1S/C9H11ClN2/c1-2-5-12-9-4-3-7(11)6-8(9)10/h2-4,6,12H,1,5,11H2 |
| InChIKey | OABDYABQBWGHAM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|