C9H10ClFN2 — CID 130507300
4-chloro-3-fluoro-2-N-prop-2-enylbenzene-1,2-diamine (PubChem CID 130507300) has the molecular formula C9H10ClFN2 and a molecular weight of 200.64 g/mol. Its IUPAC name is 4-chloro-3-fluoro-2-N-prop-2-enylbenzene-1,2-diamine.
| Compound Name | 4-chloro-3-fluoro-2-N-prop-2-enylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 130507300 |
| Molecular Formula | C9H10ClFN2 |
| Molecular Weight | 200.64 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 4-chloro-3-fluoro-2-N-prop-2-enylbenzene-1,2-diamine |
| SMILES | C=CCNc1c(N)ccc(Cl)c1F |
| InChI | InChI=1S/C9H10ClFN2/c1-2-5-13-9-7(12)4-3-6(10)8(9)11/h2-4,13H,1,5,12H2 |
| InChIKey | UWGAYDIBXNQIKJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|