C11H15N3O — CID 100639501
5-amino-N-methyl-2-(prop-2-enylamino)benzamide (PubChem CID 100639501) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-amino-N-methyl-2-(prop-2-enylamino)benzamide.
| Compound Name | 5-amino-N-methyl-2-(prop-2-enylamino)benzamide |
|---|---|
| PubChem CID | 100639501 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 5-amino-N-methyl-2-(prop-2-enylamino)benzamide |
| SMILES | C=CCNc1ccc(N)cc1C(=O)NC |
| InChI | InChI=1S/C11H15N3O/c1-3-6-14-10-5-4-8(12)7-9(10)11(15)13-2/h3-5,7,14H,1,6,12H2,2H3,(H,13,15) |
| InChIKey | WITVIBBSYFURFY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|