C10H9BrF3N — CID 115511646
2-bromo-N-prop-2-enyl-4-(trifluoromethyl)aniline (PubChem CID 115511646) has the molecular formula C10H9BrF3N and a molecular weight of 280.09 g/mol. Its IUPAC name is 2-bromo-N-prop-2-enyl-4-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-prop-2-enyl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 115511646 |
| Molecular Formula | C10H9BrF3N |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 2-bromo-N-prop-2-enyl-4-(trifluoromethyl)aniline |
| SMILES | C=CCNc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C10H9BrF3N/c1-2-5-15-9-4-3-7(6-8(9)11)10(12,13)14/h2-4,6,15H,1,5H2 |
| InChIKey | IRMNBQAIADCUQG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|