C11H13BrF3NS — CID 56636672
2-bromo-N-(2-methylsulfanylpropyl)-4-(trifluoromethyl)aniline (PubChem CID 56636672) has the molecular formula C11H13BrF3NS and a molecular weight of 328.20 g/mol. Its IUPAC name is 2-bromo-N-(2-methylsulfanylpropyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-(2-methylsulfanylpropyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 56636672 |
| Molecular Formula | C11H13BrF3NS |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-bromo-N-(2-methylsulfanylpropyl)-4-(trifluoromethyl)aniline |
| SMILES | CSC(C)CNc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H13BrF3NS/c1-7(17-2)6-16-10-4-3-8(5-9(10)12)11(13,14)15/h3-5,7,16H,6H2,1-2H3 |
| InChIKey | AMPPFGHYLDDKSL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |