C13H18BrF3N2 — CID 106155250
N'-[2-bromo-4-(trifluoromethyl)phenyl]-2-methylpentane-1,5-diamine (PubChem CID 106155250) has the molecular formula C13H18BrF3N2 and a molecular weight of 339.20 g/mol. Its IUPAC name is N'-[2-bromo-4-(trifluoromethyl)phenyl]-2-methylpentane-1,5-diamine.
| Compound Name | N'-[2-bromo-4-(trifluoromethyl)phenyl]-2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 106155250 |
| Molecular Formula | C13H18BrF3N2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N'-[2-bromo-4-(trifluoromethyl)phenyl]-2-methylpentane-1,5-diamine |
| SMILES | CC(CN)CCCNc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C13H18BrF3N2/c1-9(8-18)3-2-6-19-12-5-4-10(7-11(12)14)13(15,16)17/h4-5,7,9,19H,2-3,6,8,18H2,1H3 |
| InChIKey | OMPJKHWZEIKNLG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|