C13H17BrF3N — CID 114042779
2-bromo-N-(4-methylpentyl)-5-(trifluoromethyl)aniline (PubChem CID 114042779) has the molecular formula C13H17BrF3N and a molecular weight of 324.18 g/mol. Its IUPAC name is 2-bromo-N-(4-methylpentyl)-5-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-(4-methylpentyl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 114042779 |
| Molecular Formula | C13H17BrF3N |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-bromo-N-(4-methylpentyl)-5-(trifluoromethyl)aniline |
| SMILES | CC(C)CCCNc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C13H17BrF3N/c1-9(2)4-3-7-18-12-8-10(13(15,16)17)5-6-11(12)14/h5-6,8-9,18H,3-4,7H2,1-2H3 |
| InChIKey | OCAMWEQPUPKQSZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|