C11H13BrF3NS — CID 114042790
2-bromo-N-(2-ethylsulfanylethyl)-5-(trifluoromethyl)aniline (PubChem CID 114042790) has the molecular formula C11H13BrF3NS and a molecular weight of 328.20 g/mol. Its IUPAC name is 2-bromo-N-(2-ethylsulfanylethyl)-5-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-(2-ethylsulfanylethyl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 114042790 |
| Molecular Formula | C11H13BrF3NS |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-bromo-N-(2-ethylsulfanylethyl)-5-(trifluoromethyl)aniline |
| SMILES | CCSCCNc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C11H13BrF3NS/c1-2-17-6-5-16-10-7-8(11(13,14)15)3-4-9(10)12/h3-4,7,16H,2,5-6H2,1H3 |
| InChIKey | UZWYUYGQFZZDQJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|