C16H18F3NO2S — CID 54110348
5-(2-ethylsulfanylethylamino)-2-methyl-4-[3-(trifluoromethyl)phenyl]furan-3-ol (PubChem CID 54110348) has the molecular formula C16H18F3NO2S and a molecular weight of 345.39 g/mol. Its IUPAC name is 5-(2-ethylsulfanylethylamino)-2-methyl-4-[3-(trifluoromethyl)phenyl]furan-3-ol.
| Compound Name | 5-(2-ethylsulfanylethylamino)-2-methyl-4-[3-(trifluoromethyl)phenyl]furan-3-ol |
|---|---|
| PubChem CID | 54110348 |
| Molecular Formula | C16H18F3NO2S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 5-(2-ethylsulfanylethylamino)-2-methyl-4-[3-(trifluoromethyl)phenyl]furan-3-ol |
| SMILES | CCSCCNc1oc(C)c(O)c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F3NO2S/c1-3-23-8-7-20-15-13(14(21)10(2)22-15)11-5-4-6-12(9-11)16(17,18)19/h4-6,9,20-21H,3,7-8H2,1-2H3 |
| InChIKey | NGQKNAZVVMYVOJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|