C16H18F3NOS — CID 54282882
2-butyl-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-ol (PubChem CID 54282882) has the molecular formula C16H18F3NOS and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-butyl-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-ol.
| Compound Name | 2-butyl-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-ol |
|---|---|
| PubChem CID | 54282882 |
| Molecular Formula | C16H18F3NOS |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-butyl-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-ol |
| SMILES | CCCCc1sc(NC)c(-c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C16H18F3NOS/c1-3-4-8-12-14(21)13(15(20-2)22-12)10-6-5-7-11(9-10)16(17,18)19/h5-7,9,20-21H,3-4,8H2,1-2H3 |
| InChIKey | RSAGIMHADMURST-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|