C14H13F3S — CID 164918327
2-propyl-5-[3-(trifluoromethyl)phenyl]thiophene (PubChem CID 164918327) has the molecular formula C14H13F3S and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-propyl-5-[3-(trifluoromethyl)phenyl]thiophene.
| Compound Name | 2-propyl-5-[3-(trifluoromethyl)phenyl]thiophene |
|---|---|
| PubChem CID | 164918327 |
| Molecular Formula | C14H13F3S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-propyl-5-[3-(trifluoromethyl)phenyl]thiophene |
| SMILES | CCCc1ccc(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C14H13F3S/c1-2-4-12-7-8-13(18-12)10-5-3-6-11(9-10)14(15,16)17/h3,5-9H,2,4H2,1H3 |
| InChIKey | VCOTWKRTONNTBG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |