C20H27F3N2S — CID 159455966
4-methyl-N-nonyl-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 159455966) has the molecular formula C20H27F3N2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 4-methyl-N-nonyl-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-nonyl-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 159455966 |
| Molecular Formula | C20H27F3N2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-methyl-N-nonyl-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCCNc1nc(C)c(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C20H27F3N2S/c1-3-4-5-6-7-8-9-13-24-19-25-15(2)18(26-19)16-11-10-12-17(14-16)20(21,22)23/h10-12,14H,3-9,13H2,1-2H3,(H,24,25) |
| InChIKey | RXFKPCIFXMNTLM-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|