C21H31F3N6O — CID 23787462
6-[[4-(butylamino)-6-[[3-(trifluoromethyl)phenyl]methylamino]-1,3,5-triazin-2-yl]amino]hexan-1-ol (PubChem CID 23787462) has the molecular formula C21H31F3N6O and a molecular weight of 440.51 g/mol. Its IUPAC name is 6-[[4-(butylamino)-6-[[3-(trifluoromethyl)phenyl]methylamino]-1,3,5-triazin-2-yl]amino]hexan-1-ol.
| Compound Name | 6-[[4-(butylamino)-6-[[3-(trifluoromethyl)phenyl]methylamino]-1,3,5-triazin-2-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 23787462 |
| Molecular Formula | C21H31F3N6O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 6-[[4-(butylamino)-6-[[3-(trifluoromethyl)phenyl]methylamino]-1,3,5-triazin-2-yl]amino]hexan-1-ol |
| SMILES | CCCCNc1nc(NCCCCCCO)nc(NCc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H31F3N6O/c1-2-3-11-25-18-28-19(26-12-6-4-5-7-13-31)30-20(29-18)27-15-16-9-8-10-17(14-16)21(22,23)24/h8-10,14,31H,2-7,11-13,15H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | GYEJCUYDIOHKOV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|