C38H50N12 — CID 11093629
4-N-benzyl-2-N-[[3-[[[4-(benzylamino)-6-(pentylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-6-N-pentyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 11093629) has the molecular formula C38H50N12 and a molecular weight of 674.90 g/mol. Its IUPAC name is 4-N-benzyl-2-N-[[3-[[[4-(benzylamino)-6-(pentylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-6-N-pentyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-benzyl-2-N-[[3-[[[4-(benzylamino)-6-(pentylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-6-N-pentyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11093629 |
| Molecular Formula | C38H50N12 |
| Molecular Weight | 674.90 g/mol |
| Exact Mass | 674.43 |
| IUPAC Name | 4-N-benzyl-2-N-[[3-[[[4-(benzylamino)-6-(pentylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-6-N-pentyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCNc1nc(NCc2ccccc2)nc(NCc2cccc(CNc3nc(NCCCCC)nc(NCc4ccccc4)n3)c2)n1 |
| InChI | InChI=1S/C38H50N12/c1-3-5-13-22-39-33-45-35(41-25-29-16-9-7-10-17-29)49-37(47-33)43-27-31-20-15-21-32(24-31)28-44-38-48-34(40-23-14-6-4-2)46-36(50-38)42-26-30-18-11-8-12-19-30/h7-12,15-21,24H,3-6,13-14,22-23,25-28H2,1-2H3,(H3,39,41,43,45,47,49)(H3,40,42,44,46,48,50) |
| InChIKey | NGAAWXHPYCFCCF-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.90 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|