C24H48N6O3 — CID 139959885
7-[[4,6-bis(7-hydroxyheptylamino)-1,3,5-triazin-2-yl]amino]heptan-1-ol (PubChem CID 139959885) has the molecular formula C24H48N6O3 and a molecular weight of 468.69 g/mol. Its IUPAC name is 7-[[4,6-bis(7-hydroxyheptylamino)-1,3,5-triazin-2-yl]amino]heptan-1-ol.
| Compound Name | 7-[[4,6-bis(7-hydroxyheptylamino)-1,3,5-triazin-2-yl]amino]heptan-1-ol |
|---|---|
| PubChem CID | 139959885 |
| Molecular Formula | C24H48N6O3 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.38 |
| IUPAC Name | 7-[[4,6-bis(7-hydroxyheptylamino)-1,3,5-triazin-2-yl]amino]heptan-1-ol |
| SMILES | OCCCCCCCNc1nc(NCCCCCCCO)nc(NCCCCCCCO)n1 |
| InChI | InChI=1S/C24H48N6O3/c31-19-13-7-1-4-10-16-25-22-28-23(26-17-11-5-2-8-14-20-32)30-24(29-22)27-18-12-6-3-9-15-21-33/h31-33H,1-21H2,(H3,25,26,27,28,29,30) |
| InChIKey | XPCOZFSVPAYYHS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|