C11H18ClN3O — CID 82461024
5-[(4-chloro-5,6-dimethylpyrimidin-2-yl)amino]pentan-1-ol (PubChem CID 82461024) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is 5-[(4-chloro-5,6-dimethylpyrimidin-2-yl)amino]pentan-1-ol.
| Compound Name | 5-[(4-chloro-5,6-dimethylpyrimidin-2-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 82461024 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 5-[(4-chloro-5,6-dimethylpyrimidin-2-yl)amino]pentan-1-ol |
| SMILES | Cc1nc(NCCCCCO)nc(Cl)c1C |
| InChI | InChI=1S/C11H18ClN3O/c1-8-9(2)14-11(15-10(8)12)13-6-4-3-5-7-16/h16H,3-7H2,1-2H3,(H,13,14,15) |
| InChIKey | WTHNOWGFOSIBCG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|