C16H30N12O — CID 139460807
5-[[4-amino-6-[5-[(4,6-diamino-1,3,5-triazin-2-yl)amino]pentylamino]-1,3,5-triazin-2-yl]amino]pentan-1-ol (PubChem CID 139460807) has the molecular formula C16H30N12O and a molecular weight of 406.50 g/mol. Its IUPAC name is 5-[[4-amino-6-[5-[(4,6-diamino-1,3,5-triazin-2-yl)amino]pentylamino]-1,3,5-triazin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4-amino-6-[5-[(4,6-diamino-1,3,5-triazin-2-yl)amino]pentylamino]-1,3,5-triazin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 139460807 |
| Molecular Formula | C16H30N12O |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 5-[[4-amino-6-[5-[(4,6-diamino-1,3,5-triazin-2-yl)amino]pentylamino]-1,3,5-triazin-2-yl]amino]pentan-1-ol |
| SMILES | Nc1nc(N)nc(NCCCCCNc2nc(N)nc(NCCCCCO)n2)n1 |
| InChI | InChI=1S/C16H30N12O/c17-11-23-12(18)25-14(24-11)20-7-3-1-4-8-21-15-26-13(19)27-16(28-15)22-9-5-2-6-10-29/h29H,1-10H2,(H5,17,18,20,23,24,25)(H4,19,21,22,26,27,28) |
| InChIKey | WNFDLQCOQZLNIQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 211.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|