C18H36N6O3 — CID 12010696
5-[[4,6-bis(5-hydroxypentylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol (PubChem CID 12010696) has the molecular formula C18H36N6O3 and a molecular weight of 384.53 g/mol. Its IUPAC name is 5-[[4,6-bis(5-hydroxypentylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4,6-bis(5-hydroxypentylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 12010696 |
| Molecular Formula | C18H36N6O3 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 5-[[4,6-bis(5-hydroxypentylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
| SMILES | OCCCCCNc1nc(NCCCCCO)nc(NCCCCCO)n1 |
| InChI | InChI=1S/C18H36N6O3/c25-13-7-1-4-10-19-16-22-17(20-11-5-2-8-14-26)24-18(23-16)21-12-6-3-9-15-27/h25-27H,1-15H2,(H3,19,20,21,22,23,24) |
| InChIKey | IFSIXPJENDQJFC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|