C14H27N5O2 — CID 107855312
6-[[4-ethoxy-6-(propylamino)-1,3,5-triazin-2-yl]amino]hexan-1-ol (PubChem CID 107855312) has the molecular formula C14H27N5O2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 6-[[4-ethoxy-6-(propylamino)-1,3,5-triazin-2-yl]amino]hexan-1-ol.
| Compound Name | 6-[[4-ethoxy-6-(propylamino)-1,3,5-triazin-2-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 107855312 |
| Molecular Formula | C14H27N5O2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 6-[[4-ethoxy-6-(propylamino)-1,3,5-triazin-2-yl]amino]hexan-1-ol |
| SMILES | CCCNc1nc(NCCCCCCO)nc(OCC)n1 |
| InChI | InChI=1S/C14H27N5O2/c1-3-9-15-12-17-13(19-14(18-12)21-4-2)16-10-7-5-6-8-11-20/h20H,3-11H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | SZPCKOUNMKIVAL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|