C17H29N5O5 — CID 19427575
6-[[4-(5-carboxypentylamino)-6-ethoxy-1,3,5-triazin-2-yl]amino]hexanoic acid (PubChem CID 19427575) has the molecular formula C17H29N5O5 and a molecular weight of 383.45 g/mol. Its IUPAC name is 6-[[4-(5-carboxypentylamino)-6-ethoxy-1,3,5-triazin-2-yl]amino]hexanoic acid.
| Compound Name | 6-[[4-(5-carboxypentylamino)-6-ethoxy-1,3,5-triazin-2-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19427575 |
| Molecular Formula | C17H29N5O5 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 6-[[4-(5-carboxypentylamino)-6-ethoxy-1,3,5-triazin-2-yl]amino]hexanoic acid |
| SMILES | CCOc1nc(NCCCCCC(=O)O)nc(NCCCCCC(=O)O)n1 |
| InChI | InChI=1S/C17H29N5O5/c1-2-27-17-21-15(18-11-7-3-5-9-13(23)24)20-16(22-17)19-12-8-4-6-10-14(25)26/h2-12H2,1H3,(H,23,24)(H,25,26)(H2,18,19,20,21,22) |
| InChIKey | QQKBWXPCVOZQFV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 146.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|