C11H20N6O2 — CID 80788350
N-[2-[[4-ethoxy-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl]acetamide (PubChem CID 80788350) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[2-[[4-ethoxy-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[4-ethoxy-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 80788350 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-[2-[[4-ethoxy-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl]acetamide |
| SMILES | CCNc1nc(NCCNC(C)=O)nc(OCC)n1 |
| InChI | InChI=1S/C11H20N6O2/c1-4-12-9-15-10(14-7-6-13-8(3)18)17-11(16-9)19-5-2/h4-7H2,1-3H3,(H,13,18)(H2,12,14,15,16,17) |
| InChIKey | FBGYOVFWSJWCIX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|