C12H20ClN5O3 — CID 114518281
tert-butyl N-[2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]ethyl]carbamate (PubChem CID 114518281) has the molecular formula C12H20ClN5O3 and a molecular weight of 317.78 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 114518281 |
| Molecular Formula | C12H20ClN5O3 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | tert-butyl N-[2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]ethyl]carbamate |
| SMILES | CCOc1nc(Cl)nc(NCCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C12H20ClN5O3/c1-5-20-10-17-8(13)16-9(18-10)14-6-7-15-11(19)21-12(2,3)4/h5-7H2,1-4H3,(H,15,19)(H,14,16,17,18) |
| InChIKey | ZRMAMPBQLAKPAO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|