C13H23N5O4 — CID 103702920
tert-butyl N-[3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]propyl]carbamate (PubChem CID 103702920) has the molecular formula C13H23N5O4 and a molecular weight of 313.36 g/mol. Its IUPAC name is tert-butyl N-[3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 103702920 |
| Molecular Formula | C13H23N5O4 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | tert-butyl N-[3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]propyl]carbamate |
| SMILES | COc1nc(NCCCNC(=O)OC(C)(C)C)nc(OC)n1 |
| InChI | InChI=1S/C13H23N5O4/c1-13(2,3)22-12(19)15-8-6-7-14-9-16-10(20-4)18-11(17-9)21-5/h6-8H2,1-5H3,(H,15,19)(H,14,16,17,18) |
| InChIKey | QONJAGJLTKEQJI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|