C27H41N5O5 — CID 58223013
methyl 4-[[4-ethoxy-6-[8-[(2-methylpropan-2-yl)oxycarbonylamino]octylamino]-1,3,5-triazin-2-yl]methyl]benzoate (PubChem CID 58223013) has the molecular formula C27H41N5O5 and a molecular weight of 515.66 g/mol. Its IUPAC name is methyl 4-[[4-ethoxy-6-[8-[(2-methylpropan-2-yl)oxycarbonylamino]octylamino]-1,3,5-triazin-2-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-ethoxy-6-[8-[(2-methylpropan-2-yl)oxycarbonylamino]octylamino]-1,3,5-triazin-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 58223013 |
| Molecular Formula | C27H41N5O5 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | methyl 4-[[4-ethoxy-6-[8-[(2-methylpropan-2-yl)oxycarbonylamino]octylamino]-1,3,5-triazin-2-yl]methyl]benzoate |
| SMILES | CCOc1nc(Cc2ccc(C(=O)OC)cc2)nc(NCCCCCCCCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C27H41N5O5/c1-6-36-25-31-22(19-20-13-15-21(16-14-20)23(33)35-5)30-24(32-25)28-17-11-9-7-8-10-12-18-29-26(34)37-27(2,3)4/h13-16H,6-12,17-19H2,1-5H3,(H,29,34)(H,28,30,31,32) |
| InChIKey | YTNTYBVFEDHEHL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|