C14H14ClN3O3 — CID 58222965
methyl 4-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)methyl]benzoate (PubChem CID 58222965) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is methyl 4-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)methyl]benzoate.
| Compound Name | methyl 4-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 58222965 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | methyl 4-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)methyl]benzoate |
| SMILES | CCOc1nc(Cl)nc(Cc2ccc(C(=O)OC)cc2)n1 |
| InChI | InChI=1S/C14H14ClN3O3/c1-3-21-14-17-11(16-13(15)18-14)8-9-4-6-10(7-5-9)12(19)20-2/h4-7H,3,8H2,1-2H3 |
| InChIKey | QYRULWAYZDVTOI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |