C24H29N5O3 — CID 58223036
tert-butyl 4-[[4-[(4-aminophenyl)methylamino]-6-ethoxy-1,3,5-triazin-2-yl]methyl]benzoate (PubChem CID 58223036) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(4-aminophenyl)methylamino]-6-ethoxy-1,3,5-triazin-2-yl]methyl]benzoate.
| Compound Name | tert-butyl 4-[[4-[(4-aminophenyl)methylamino]-6-ethoxy-1,3,5-triazin-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 58223036 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | tert-butyl 4-[[4-[(4-aminophenyl)methylamino]-6-ethoxy-1,3,5-triazin-2-yl]methyl]benzoate |
| SMILES | CCOc1nc(Cc2ccc(C(=O)OC(C)(C)C)cc2)nc(NCc2ccc(N)cc2)n1 |
| InChI | InChI=1S/C24H29N5O3/c1-5-31-23-28-20(27-22(29-23)26-15-17-8-12-19(25)13-9-17)14-16-6-10-18(11-7-16)21(30)32-24(2,3)4/h6-13H,5,14-15,25H2,1-4H3,(H,26,27,28,29) |
| InChIKey | OIBSIYXMWCFJIA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|