C27H29BrClF3N4O4 — CID 158999999
tert-butyl 4-[[4-[[4-(3-bromopropoxy)-3-chlorophenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]benzoate (PubChem CID 158999999) has the molecular formula C27H29BrClF3N4O4 and a molecular weight of 645.90 g/mol. Its IUPAC name is tert-butyl 4-[[4-[[4-(3-bromopropoxy)-3-chlorophenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]benzoate.
| Compound Name | tert-butyl 4-[[4-[[4-(3-bromopropoxy)-3-chlorophenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 158999999 |
| Molecular Formula | C27H29BrClF3N4O4 |
| Molecular Weight | 645.90 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | tert-butyl 4-[[4-[[4-(3-bromopropoxy)-3-chlorophenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Cc2nc(NCc3ccc(OCCCBr)c(Cl)c3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C27H29BrClF3N4O4/c1-26(2,3)40-23(37)19-8-5-17(6-9-19)14-22-34-24(36-25(35-22)39-16-27(30,31)32)33-15-18-7-10-21(20(29)13-18)38-12-4-11-28/h5-10,13H,4,11-12,14-16H2,1-3H3,(H,33,34,35,36) |
| InChIKey | MKKYZJLXZFGXEW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.90 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|