C25H33F6N7O4 — CID 87338840
tert-butyl 4-[[4-[2-[5-aminopentyl-(2,2,2-trifluoroacetyl)amino]ethylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 87338840) has the molecular formula C25H33F6N7O4 and a molecular weight of 609.57 g/mol. Its IUPAC name is tert-butyl 4-[[4-[2-[5-aminopentyl-(2,2,2-trifluoroacetyl)amino]ethylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | tert-butyl 4-[[4-[2-[5-aminopentyl-(2,2,2-trifluoroacetyl)amino]ethylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 87338840 |
| Molecular Formula | C25H33F6N7O4 |
| Molecular Weight | 609.57 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | tert-butyl 4-[[4-[2-[5-aminopentyl-(2,2,2-trifluoroacetyl)amino]ethylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Nc2nc(NCCN(CCCCCN)C(=O)C(F)(F)F)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C25H33F6N7O4/c1-23(2,3)42-18(39)16-7-9-17(10-8-16)34-21-35-20(36-22(37-21)41-15-24(26,27)28)33-12-14-38(13-6-4-5-11-32)19(40)25(29,30)31/h7-10H,4-6,11-15,32H2,1-3H3,(H2,33,34,35,36,37) |
| InChIKey | AGUZNIGRNIORLQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|