C25H29ClF3N9O2 — CID 129156789
4-[[4-[(4-chlorophenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]benzamide (PubChem CID 129156789) has the molecular formula C25H29ClF3N9O2 and a molecular weight of 580.02 g/mol. Its IUPAC name is 4-[[4-[(4-chlorophenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]benzamide.
| Compound Name | 4-[[4-[(4-chlorophenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 129156789 |
| Molecular Formula | C25H29ClF3N9O2 |
| Molecular Weight | 580.02 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 4-[[4-[(4-chlorophenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]benzamide |
| SMILES | C[C@H](CCCN=C(N)N)NC(=O)c1ccc(Nc2nc(NCc3ccc(Cl)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C25H29ClF3N9O2/c1-15(3-2-12-32-21(30)31)34-20(39)17-6-10-19(11-7-17)35-23-36-22(33-13-16-4-8-18(26)9-5-16)37-24(38-23)40-14-25(27,28)29/h4-11,15H,2-3,12-14H2,1H3,(H,34,39)(H4,30,31,32)(H2,33,35,36,37,38)/t15-/m1/s1 |
| InChIKey | PAFYHAMWZIKZIZ-OAHLLOKOSA-N |
| XLogP | 3.99 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.02 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|