C24H27ClF3N9O3 — CID 90304466
(2S)-2-[4-[[4-[(4-chlorophenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 90304466) has the molecular formula C24H27ClF3N9O3 and a molecular weight of 581.99 g/mol. Its IUPAC name is (2S)-2-[4-[[4-[(4-chlorophenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[4-[[4-[(4-chlorophenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 90304466 |
| Molecular Formula | C24H27ClF3N9O3 |
| Molecular Weight | 581.99 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (2S)-2-[4-[[4-[(4-chlorophenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](Nc1ccc(Nc2nc(NCc3ccc(Cl)cc3)nc(OCC(F)(F)F)n2)cc1)C(=O)O |
| InChI | InChI=1S/C24H27ClF3N9O3/c25-15-5-3-14(4-6-15)12-32-21-35-22(37-23(36-21)40-13-24(26,27)28)34-17-9-7-16(8-10-17)33-18(19(38)39)2-1-11-31-20(29)30/h3-10,18,33H,1-2,11-13H2,(H,38,39)(H4,29,30,31)(H2,32,34,35,36,37)/t18-/m0/s1 |
| InChIKey | QXVPFKMXVBVPQP-SFHVURJKSA-N |
| XLogP | 3.74 |
| TPSA | 185.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.99 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|