C27H31ClF3N9O2 — CID 129156801
4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]benzamide (PubChem CID 129156801) has the molecular formula C27H31ClF3N9O2 and a molecular weight of 606.05 g/mol. Its IUPAC name is 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]benzamide.
| Compound Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 129156801 |
| Molecular Formula | C27H31ClF3N9O2 |
| Molecular Weight | 606.05 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]benzamide |
| SMILES | C[C@H](CCCN=C(N)N)NC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C27H31ClF3N9O2/c1-16(3-2-14-34-22(32)33)35-21(41)17-4-10-20(11-5-17)36-23-37-24(39-25(38-23)42-15-27(29,30)31)40-26(12-13-26)18-6-8-19(28)9-7-18/h4-11,16H,2-3,12-15H2,1H3,(H,35,41)(H4,32,33,34)(H2,36,37,38,39,40)/t16-/m1/s1 |
| InChIKey | XZMXKMNEGRONIC-MRXNPFEDSA-N |
| XLogP | 4.48 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.05 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|