C33H37ClF3N7O6 — CID 158098772
ethyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-8-(dimethylamino)-7,8-dioxooctanoate (PubChem CID 158098772) has the molecular formula C33H37ClF3N7O6 and a molecular weight of 720.15 g/mol. Its IUPAC name is ethyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-8-(dimethylamino)-7,8-dioxooctanoate.
| Compound Name | ethyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-8-(dimethylamino)-7,8-dioxooctanoate |
|---|---|
| PubChem CID | 158098772 |
| Molecular Formula | C33H37ClF3N7O6 |
| Molecular Weight | 720.15 g/mol |
| Exact Mass | 719.24 |
| IUPAC Name | ethyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-8-(dimethylamino)-7,8-dioxooctanoate |
| SMILES | CCOC(=O)[C@H](CCCCC(=O)C(=O)N(C)C)NC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C33H37ClF3N7O6/c1-4-49-28(48)24(7-5-6-8-25(45)27(47)44(2)3)39-26(46)20-9-15-23(16-10-20)38-29-40-30(42-31(41-29)50-19-33(35,36)37)43-32(17-18-32)21-11-13-22(34)14-12-21/h9-16,24H,4-8,17-19H2,1-3H3,(H,39,46)(H2,38,40,41,42,43)/t24-/m0/s1 |
| InChIKey | FOZOKWWJMQXCCH-DEOSSOPVSA-N |
| XLogP | 5.19 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.15 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|