C30H36ClF3N7O4+ — CID 77107052
[(5S)-5-carboxy-5-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]pentyl]-trimethylazanium (PubChem CID 77107052) has the molecular formula C30H36ClF3N7O4+ and a molecular weight of 651.11 g/mol. Its IUPAC name is [(5S)-5-carboxy-5-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]pentyl]-trimethylazanium.
| Compound Name | [(5S)-5-carboxy-5-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]pentyl]-trimethylazanium |
|---|---|
| PubChem CID | 77107052 |
| Molecular Formula | C30H36ClF3N7O4+ |
| Molecular Weight | 651.11 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | [(5S)-5-carboxy-5-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]pentyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CCCC[C@H](NC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1)C(=O)O |
| InChI | InChI=1S/C30H35ClF3N7O4/c1-41(2,3)17-5-4-6-23(25(43)44)36-24(42)19-7-13-22(14-8-19)35-26-37-27(39-28(38-26)45-18-30(32,33)34)40-29(15-16-29)20-9-11-21(31)12-10-20/h7-14,23H,4-6,15-18H2,1-3H3,(H3-,35,36,37,38,39,40,42,43,44)/p+1/t23-/m0/s1 |
| InChIKey | DVHOLSSKXSIUSH-QHCPKHFHSA-O |
| XLogP | 5.37 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.11 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|