C27H32ClF3N7O2+ — CID 77107452
3-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propyl-trimethylazanium (PubChem CID 77107452) has the molecular formula C27H32ClF3N7O2+ and a molecular weight of 579.05 g/mol. Its IUPAC name is 3-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 77107452 |
| Molecular Formula | C27H32ClF3N7O2+ |
| Molecular Weight | 579.05 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 3-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCNC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C27H31ClF3N7O2/c1-38(2,3)16-4-15-32-22(39)18-5-11-21(12-6-18)33-23-34-24(36-25(35-23)40-17-27(29,30)31)37-26(13-14-26)19-7-9-20(28)10-8-19/h5-12H,4,13-17H2,1-3H3,(H2-,32,33,34,35,36,37,39)/p+1 |
| InChIKey | NAQDLOYNQFBXGO-UHFFFAOYSA-O |
| XLogP | 5.14 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|