C30H29ClF3N7O7 — CID 144674533
4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[2-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl]benzamide;methyl formate (PubChem CID 144674533) has the molecular formula C30H29ClF3N7O7 and a molecular weight of 692.05 g/mol. Its IUPAC name is 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[2-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl]benzamide;methyl formate.
| Compound Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[2-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl]benzamide;methyl formate |
|---|---|
| PubChem CID | 144674533 |
| Molecular Formula | C30H29ClF3N7O7 |
| Molecular Weight | 692.05 g/mol |
| Exact Mass | 691.18 |
| IUPAC Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[2-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl]benzamide;methyl formate |
| SMILES | COC=O.COc1c(NCCNC(=O)c2ccc(Nc3nc(NC4(c5ccc(Cl)cc5)CC4)nc(OCC(F)(F)F)n3)cc2)c(=O)c1=O |
| InChI | InChI=1S/C28H25ClF3N7O5.C2H4O2/c1-43-22-19(20(40)21(22)41)33-12-13-34-23(42)15-2-8-18(9-3-15)35-24-36-25(38-26(37-24)44-14-28(30,31)32)39-27(10-11-27)16-4-6-17(29)7-5-16;1-4-2-3/h2-9,33H,10-14H2,1H3,(H,34,42)(H2,35,36,37,38,39);2H,1H3 |
| InChIKey | VXOCSLACBIUISB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.05 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|