C35H41ClF3N7O4 — CID 158184337
4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[3-[(3-cyclohexyl-2-oxopropanoyl)amino]-2,2-dimethylpropyl]benzamide (PubChem CID 158184337) has the molecular formula C35H41ClF3N7O4 and a molecular weight of 716.21 g/mol. Its IUPAC name is 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[3-[(3-cyclohexyl-2-oxopropanoyl)amino]-2,2-dimethylpropyl]benzamide.
| Compound Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[3-[(3-cyclohexyl-2-oxopropanoyl)amino]-2,2-dimethylpropyl]benzamide |
|---|---|
| PubChem CID | 158184337 |
| Molecular Formula | C35H41ClF3N7O4 |
| Molecular Weight | 716.21 g/mol |
| Exact Mass | 715.29 |
| IUPAC Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[3-[(3-cyclohexyl-2-oxopropanoyl)amino]-2,2-dimethylpropyl]benzamide |
| SMILES | CC(C)(CNC(=O)C(=O)CC1CCCCC1)CNC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C35H41ClF3N7O4/c1-33(2,20-41-29(49)27(47)18-22-6-4-3-5-7-22)19-40-28(48)23-8-14-26(15-9-23)42-30-43-31(45-32(44-30)50-21-35(37,38)39)46-34(16-17-34)24-10-12-25(36)13-11-24/h8-15,22H,3-7,16-21H2,1-2H3,(H,40,48)(H,41,49)(H2,42,43,44,45,46) |
| InChIKey | FYYTVQBVDLUAKF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.21 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|