C29H27ClF3N7O5 — CID 123767832
4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl]benzamide (PubChem CID 123767832) has the molecular formula C29H27ClF3N7O5 and a molecular weight of 646.03 g/mol. Its IUPAC name is 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl]benzamide.
| Compound Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 123767832 |
| Molecular Formula | C29H27ClF3N7O5 |
| Molecular Weight | 646.03 g/mol |
| Exact Mass | 645.17 |
| IUPAC Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl]benzamide |
| SMILES | CCOc1c(NCCNC(=O)c2ccc(Nc3nc(NC4(c5ccc(Cl)cc5)CC4)nc(OCC(F)(F)F)n3)cc2)c(=O)c1=O |
| InChI | InChI=1S/C29H27ClF3N7O5/c1-2-44-23-20(21(41)22(23)42)34-13-14-35-24(43)16-3-9-19(10-4-16)36-25-37-26(39-27(38-25)45-15-29(31,32)33)40-28(11-12-28)17-5-7-18(30)8-6-17/h3-10,34H,2,11-15H2,1H3,(H,35,43)(H2,36,37,38,39,40) |
| InChIKey | NUJSZYXHDAQAQM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.03 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|