C35H34ClF4N7O4 — CID 160507856
4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[3-[[3-(4-fluorophenyl)-2-oxopropanoyl]amino]-2,2-dimethylpropyl]benzamide (PubChem CID 160507856) has the molecular formula C35H34ClF4N7O4 and a molecular weight of 728.15 g/mol. Its IUPAC name is 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[3-[[3-(4-fluorophenyl)-2-oxopropanoyl]amino]-2,2-dimethylpropyl]benzamide.
| Compound Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[3-[[3-(4-fluorophenyl)-2-oxopropanoyl]amino]-2,2-dimethylpropyl]benzamide |
|---|---|
| PubChem CID | 160507856 |
| Molecular Formula | C35H34ClF4N7O4 |
| Molecular Weight | 728.15 g/mol |
| Exact Mass | 727.23 |
| IUPAC Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[3-[[3-(4-fluorophenyl)-2-oxopropanoyl]amino]-2,2-dimethylpropyl]benzamide |
| SMILES | CC(C)(CNC(=O)C(=O)Cc1ccc(F)cc1)CNC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C35H34ClF4N7O4/c1-33(2,19-42-29(50)27(48)17-21-3-11-25(37)12-4-21)18-41-28(49)22-5-13-26(14-6-22)43-30-44-31(46-32(45-30)51-20-35(38,39)40)47-34(15-16-34)23-7-9-24(36)10-8-23/h3-14H,15-20H2,1-2H3,(H,41,49)(H,42,50)(H2,43,44,45,46,47) |
| InChIKey | QSQNCKLHAMAFII-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.15 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|