C34H32ClF3N8O6 — CID 160731345
methyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-4-[(2-oxo-3-pyridin-3-ylpropanoyl)amino]butanoate (PubChem CID 160731345) has the molecular formula C34H32ClF3N8O6 and a molecular weight of 741.13 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-4-[(2-oxo-3-pyridin-3-ylpropanoyl)amino]butanoate.
| Compound Name | methyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-4-[(2-oxo-3-pyridin-3-ylpropanoyl)amino]butanoate |
|---|---|
| PubChem CID | 160731345 |
| Molecular Formula | C34H32ClF3N8O6 |
| Molecular Weight | 741.13 g/mol |
| Exact Mass | 740.21 |
| IUPAC Name | methyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-4-[(2-oxo-3-pyridin-3-ylpropanoyl)amino]butanoate |
| SMILES | COC(=O)[C@H](CCNC(=O)C(=O)Cc1cccnc1)NC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C34H32ClF3N8O6/c1-51-29(50)25(12-16-40-28(49)26(47)17-20-3-2-15-39-18-20)42-27(48)21-4-10-24(11-5-21)41-30-43-31(45-32(44-30)52-19-34(36,37)38)46-33(13-14-33)22-6-8-23(35)9-7-22/h2-11,15,18,25H,12-14,16-17,19H2,1H3,(H,40,49)(H,42,48)(H2,41,43,44,45,46)/t25-/m0/s1 |
| InChIKey | RUJOKSUEJGTKHZ-VWLOTQADSA-N |
| XLogP | 4.30 |
| TPSA | 186.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.13 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|